C23H23N3O6 — CID 19298328
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(2,6-dimethylphenoxy)methyl]furan-2-carboxylate (PubChem CID 19298328) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(2,6-dimethylphenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(2,6-dimethylphenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19298328 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(2,6-dimethylphenoxy)methyl]furan-2-carboxylate |
| SMILES | Cc1cccc(C)c1OCc1ccc(C(=O)O/N=C(\N)c2ccc(OCC(N)=O)cc2)o1 |
| InChI | InChI=1S/C23H23N3O6/c1-14-4-3-5-15(2)21(14)30-12-18-10-11-19(31-18)23(28)32-26-22(25)16-6-8-17(9-7-16)29-13-20(24)27/h3-11H,12-13H2,1-2H3,(H2,24,27)(H2,25,26) |
| InChIKey | NBUMADIEUAOYHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|