C20H16ClFN2O4 — CID 19291920
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate (PubChem CID 19291920) has the molecular formula C20H16ClFN2O4 and a molecular weight of 402.81 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19291920 |
| Molecular Formula | C20H16ClFN2O4 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate |
| SMILES | Cc1cc(Cl)ccc1OCc1ccc(C(=O)O/N=C(\N)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H16ClFN2O4/c1-12-10-14(21)4-8-17(12)26-11-16-7-9-18(27-16)20(25)28-24-19(23)13-2-5-15(22)6-3-13/h2-10H,11H2,1H3,(H2,23,24) |
| InChIKey | CFMDUIUXJCKRTO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|