C20H15BrCl2N2O5 — CID 19296107
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-carboxylate (PubChem CID 19296107) has the molecular formula C20H15BrCl2N2O5 and a molecular weight of 514.16 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19296107 |
| Molecular Formula | C20H15BrCl2N2O5 |
| Molecular Weight | 514.16 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-carboxylate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)c1ccc(COc2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C20H15BrCl2N2O5/c1-27-16-6-3-12(22)9-14(16)19(24)25-30-20(26)18-7-4-13(29-18)10-28-17-5-2-11(21)8-15(17)23/h2-9H,10H2,1H3,(H2,24,25) |
| InChIKey | QDXPHHIMCNRKIC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.16 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|