C22H20ClN3O6 — CID 19298384
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate (PubChem CID 19298384) has the molecular formula C22H20ClN3O6 and a molecular weight of 457.87 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19298384 |
| Molecular Formula | C22H20ClN3O6 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 5-[(4-chloro-2-methylphenoxy)methyl]furan-2-carboxylate |
| SMILES | Cc1cc(Cl)ccc1OCc1ccc(C(=O)O/N=C(\N)c2ccc(OCC(N)=O)cc2)o1 |
| InChI | InChI=1S/C22H20ClN3O6/c1-13-10-15(23)4-8-18(13)30-11-17-7-9-19(31-17)22(28)32-26-21(25)14-2-5-16(6-3-14)29-12-20(24)27/h2-10H,11-12H2,1H3,(H2,24,27)(H2,25,26) |
| InChIKey | NDPGPIONVQKYIJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|