C22H17Cl3N2O4 — CID 28958492
[(E)-[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 28958492) has the molecular formula C22H17Cl3N2O4 and a molecular weight of 479.75 g/mol. Its IUPAC name is [(E)-[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(E)-[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 28958492 |
| Molecular Formula | C22H17Cl3N2O4 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | [(E)-[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | N/C(=N/OC(=O)COc1ccc(Cl)cc1Cl)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17Cl3N2O4/c23-16-5-1-14(2-6-16)12-29-18-8-3-15(4-9-18)22(26)27-31-21(28)13-30-20-10-7-17(24)11-19(20)25/h1-11H,12-13H2,(H2,26,27) |
| InChIKey | DNJWYPSIMRTSHF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|