C16H13Cl3N2O3 — CID 2726450
[[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2,2-dichloroacetate (PubChem CID 2726450) has the molecular formula C16H13Cl3N2O3 and a molecular weight of 387.65 g/mol. Its IUPAC name is [[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2,2-dichloroacetate.
| Compound Name | [[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 2726450 |
| Molecular Formula | C16H13Cl3N2O3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | [[amino-[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]amino] 2,2-dichloroacetate |
| SMILES | NC(=NOC(=O)C(Cl)Cl)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H13Cl3N2O3/c17-12-5-1-10(2-6-12)9-23-13-7-3-11(4-8-13)15(20)21-24-16(22)14(18)19/h1-8,14H,9H2,(H2,20,21) |
| InChIKey | ZCZLAWFGBJXPKA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|