C17H13Cl2NO5 — CID 88788273
2-(2,2-dichloroacetyl)oxyimino-2-(4-phenylmethoxyphenyl)acetic acid (PubChem CID 88788273) has the molecular formula C17H13Cl2NO5 and a molecular weight of 382.20 g/mol. Its IUPAC name is 2-(2,2-dichloroacetyl)oxyimino-2-(4-phenylmethoxyphenyl)acetic acid.
| Compound Name | 2-(2,2-dichloroacetyl)oxyimino-2-(4-phenylmethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 88788273 |
| Molecular Formula | C17H13Cl2NO5 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-(2,2-dichloroacetyl)oxyimino-2-(4-phenylmethoxyphenyl)acetic acid |
| SMILES | O=C(O)C(=NOC(=O)C(Cl)Cl)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H13Cl2NO5/c18-15(19)17(23)25-20-14(16(21)22)12-6-8-13(9-7-12)24-10-11-4-2-1-3-5-11/h1-9,15H,10H2,(H,21,22) |
| InChIKey | CIYXBPYTRNIRMN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|