C16H13Cl3N2O5S — CID 134101638
[(Z)-[1-amino-2-(4-chlorophenyl)sulfonylethylidene]amino] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 134101638) has the molecular formula C16H13Cl3N2O5S and a molecular weight of 451.72 g/mol. Its IUPAC name is [(Z)-[1-amino-2-(4-chlorophenyl)sulfonylethylidene]amino] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(Z)-[1-amino-2-(4-chlorophenyl)sulfonylethylidene]amino] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 134101638 |
| Molecular Formula | C16H13Cl3N2O5S |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | [(Z)-[1-amino-2-(4-chlorophenyl)sulfonylethylidene]amino] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | N/C(CS(=O)(=O)c1ccc(Cl)cc1)=N\OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O5S/c17-10-1-4-12(5-2-10)27(23,24)9-15(20)21-26-16(22)8-25-14-6-3-11(18)7-13(14)19/h1-7H,8-9H2,(H2,20,21) |
| InChIKey | LHLJGSCEDXQQSF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|