C12H14Cl2NO6P — CID 173409696
[N-[2-(2,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]-ethoxyphosphinic acid (PubChem CID 173409696) has the molecular formula C12H14Cl2NO6P and a molecular weight of 370.13 g/mol. Its IUPAC name is [N-[2-(2,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]-ethoxyphosphinic acid.
| Compound Name | [N-[2-(2,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 173409696 |
| Molecular Formula | C12H14Cl2NO6P |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | [N-[2-(2,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(C)=NOC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2NO6P/c1-3-20-22(17,18)8(2)15-21-12(16)7-19-11-5-4-9(13)6-10(11)14/h4-6H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | YPQMLMYRCSCRSN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|