C14H18Cl2NO6P — CID 173409557
butan-2-yloxy-[N-[2-(3,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]phosphinic acid (PubChem CID 173409557) has the molecular formula C14H18Cl2NO6P and a molecular weight of 398.18 g/mol. Its IUPAC name is butan-2-yloxy-[N-[2-(3,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[N-[2-(3,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]phosphinic acid |
|---|---|
| PubChem CID | 173409557 |
| Molecular Formula | C14H18Cl2NO6P |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | butan-2-yloxy-[N-[2-(3,4-dichlorophenoxy)acetyl]oxy-C-methylcarbonimidoyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(C)=NOC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2NO6P/c1-4-9(2)23-24(19,20)10(3)17-22-14(18)8-21-11-5-6-12(15)13(16)7-11/h5-7,9H,4,8H2,1-3H3,(H,19,20) |
| InChIKey | XERYXLLNUGAPCL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|