C17H12Cl2N2O4S — CID 19296303
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxylate (PubChem CID 19296303) has the molecular formula C17H12Cl2N2O4S and a molecular weight of 411.27 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 19296303 |
| Molecular Formula | C17H12Cl2N2O4S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 5-[(2,4-dichlorophenoxy)methyl]furan-2-carboxylate |
| SMILES | N/C(=N\OC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1)c1cccs1 |
| InChI | InChI=1S/C17H12Cl2N2O4S/c18-10-3-5-13(12(19)8-10)23-9-11-4-6-14(24-11)17(22)25-21-16(20)15-2-1-7-26-15/h1-8H,9H2,(H2,20,21) |
| InChIKey | RZGGBYNWBQYGMR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|