C22H17Cl3N2O4 — CID 19296123
[(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[(2,3-dichlorophenoxy)methyl]benzoate (PubChem CID 19296123) has the molecular formula C22H17Cl3N2O4 and a molecular weight of 479.75 g/mol. Its IUPAC name is [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[(2,3-dichlorophenoxy)methyl]benzoate.
| Compound Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[(2,3-dichlorophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 19296123 |
| Molecular Formula | C22H17Cl3N2O4 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | [(Z)-[amino-(5-chloro-2-methoxyphenyl)methylidene]amino] 3-[(2,3-dichlorophenoxy)methyl]benzoate |
| SMILES | COc1ccc(Cl)cc1/C(N)=N/OC(=O)c1cccc(COc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C22H17Cl3N2O4/c1-29-18-9-8-15(23)11-16(18)21(26)27-31-22(28)14-5-2-4-13(10-14)12-30-19-7-3-6-17(24)20(19)25/h2-11H,12H2,1H3,(H2,26,27) |
| InChIKey | GDFYOQZFXBTMBQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|