C18H14Cl2F4N2O3 — CID 19292137
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-(2,2,3,3-tetrafluoropropoxymethyl)benzoate (PubChem CID 19292137) has the molecular formula C18H14Cl2F4N2O3 and a molecular weight of 453.22 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-(2,2,3,3-tetrafluoropropoxymethyl)benzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-(2,2,3,3-tetrafluoropropoxymethyl)benzoate |
|---|---|
| PubChem CID | 19292137 |
| Molecular Formula | C18H14Cl2F4N2O3 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-(2,2,3,3-tetrafluoropropoxymethyl)benzoate |
| SMILES | N/C(=N\OC(=O)c1cccc(COCC(F)(F)C(F)F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2F4N2O3/c19-12-4-5-13(14(20)7-12)15(25)26-29-16(27)11-3-1-2-10(6-11)8-28-9-18(23,24)17(21)22/h1-7,17H,8-9H2,(H2,25,26) |
| InChIKey | OJFRRDXRTJBXMT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|