C18H18F4N2O3 — CID 4775827
N-(2,4-dimethyl-6-oxo-1-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 4775827) has the molecular formula C18H18F4N2O3 and a molecular weight of 386.35 g/mol. Its IUPAC name is N-(2,4-dimethyl-6-oxo-1-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-(2,4-dimethyl-6-oxo-1-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 4775827 |
| Molecular Formula | C18H18F4N2O3 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2,4-dimethyl-6-oxo-1-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | Cc1cc(C)n(NC(=O)c2cccc(COCC(F)(F)C(F)F)c2)c(=O)c1 |
| InChI | InChI=1S/C18H18F4N2O3/c1-11-6-12(2)24(15(25)7-11)23-16(26)14-5-3-4-13(8-14)9-27-10-18(21,22)17(19)20/h3-8,17H,9-10H2,1-2H3,(H,23,26) |
| InChIKey | QYDJUOAPWQOJBD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|