C18H21F4N3O2 — CID 19282185
3-(2,2,3,3-tetrafluoropropoxymethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide (PubChem CID 19282185) has the molecular formula C18H21F4N3O2 and a molecular weight of 387.38 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropoxymethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-(2,2,3,3-tetrafluoropropoxymethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19282185 |
| Molecular Formula | C18H21F4N3O2 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropoxymethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H21F4N3O2/c1-11-15(12(2)25(3)24-11)8-23-16(26)14-6-4-5-13(7-14)9-27-10-18(21,22)17(19)20/h4-7,17H,8-10H2,1-3H3,(H,23,26) |
| InChIKey | KYZFKZAGONKCMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|