C23H18F9N3O2 — CID 19401967
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 19401967) has the molecular formula C23H18F9N3O2 and a molecular weight of 539.40 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 19401967 |
| Molecular Formula | C23H18F9N3O2 |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C23H18F9N3O2/c1-10-20(11(2)35(34-10)7-14-15(24)17(26)19(28)18(27)16(14)25)33-21(36)13-5-3-4-12(6-13)8-37-9-23(31,32)22(29)30/h3-6,22H,7-9H2,1-2H3,(H,33,36) |
| InChIKey | NPDAGUQDKXVMQJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|