C21H18F5N3O2 — CID 19285860
N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 19285860) has the molecular formula C21H18F5N3O2 and a molecular weight of 439.38 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 19285860 |
| Molecular Formula | C21H18F5N3O2 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | O=C(Nc1ccn(Cc2ccccc2F)n1)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C21H18F5N3O2/c22-17-7-2-1-5-16(17)11-29-9-8-18(28-29)27-19(30)15-6-3-4-14(10-15)12-31-13-21(25,26)20(23)24/h1-10,20H,11-13H2,(H,27,28,30) |
| InChIKey | SSROJEYTLKICQJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|