C28H28FN3O2 — CID 19286039
3-[(4-tert-butylphenoxy)methyl]-N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286039) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[(4-tert-butylphenoxy)methyl]-N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-[(4-tert-butylphenoxy)methyl]-N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286039 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 3-[(4-tert-butylphenoxy)methyl]-N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2cccc(C(=O)Nc3ccn(Cc4ccccc4F)n3)c2)cc1 |
| InChI | InChI=1S/C28H28FN3O2/c1-28(2,3)23-11-13-24(14-12-23)34-19-20-7-6-9-21(17-20)27(33)30-26-15-16-32(31-26)18-22-8-4-5-10-25(22)29/h4-17H,18-19H2,1-3H3,(H,30,31,33) |
| InChIKey | NTRHXQFLGZWZDR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |