C24H16F4N4O4 — CID 19286553
3-[(4-nitrophenoxy)methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286553) has the molecular formula C24H16F4N4O4 and a molecular weight of 500.41 g/mol. Its IUPAC name is 3-[(4-nitrophenoxy)methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-[(4-nitrophenoxy)methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286553 |
| Molecular Formula | C24H16F4N4O4 |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 3-[(4-nitrophenoxy)methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1cccc(COc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C24H16F4N4O4/c25-19-11-20(26)23(28)18(22(19)27)12-31-9-8-21(30-31)29-24(33)15-3-1-2-14(10-15)13-36-17-6-4-16(5-7-17)32(34)35/h1-11H,12-13H2,(H,29,30,33) |
| InChIKey | QBPQAAMKSRRJBP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|