C24H15ClF5N3O2 — CID 19286735
3-[(4-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286735) has the molecular formula C24H15ClF5N3O2 and a molecular weight of 507.85 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286735 |
| Molecular Formula | C24H15ClF5N3O2 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1cccc(COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H15ClF5N3O2/c25-15-4-6-16(7-5-15)35-12-13-2-1-3-14(10-13)24(34)31-18-8-9-33(32-18)11-17-19(26)21(28)23(30)22(29)20(17)27/h1-10H,11-12H2,(H,31,32,34) |
| InChIKey | MKBZBCPVEUZCSB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|