C24H19Cl2N3O2 — CID 19283688
3-[(2-chlorophenoxy)methyl]-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19283688) has the molecular formula C24H19Cl2N3O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19283688 |
| Molecular Formula | C24H19Cl2N3O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-[(2-chlorophenoxy)methyl]-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)c1cccc(COc2ccccc2Cl)c1 |
| InChI | InChI=1S/C24H19Cl2N3O2/c25-20-10-8-17(9-11-20)15-29-13-12-23(28-29)27-24(30)19-5-3-4-18(14-19)16-31-22-7-2-1-6-21(22)26/h1-14H,15-16H2,(H,27,28,30) |
| InChIKey | DHCSURQQZKNQLV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |