C25H20Cl2N4O4 — CID 19339553
N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide (PubChem CID 19339553) has the molecular formula C25H20Cl2N4O4 and a molecular weight of 511.37 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19339553 |
| Molecular Formula | C25H20Cl2N4O4 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(COc3ccc([N+](=O)[O-])cc3)c2)nn1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H20Cl2N4O4/c1-16-12-24(29-30(16)14-21-22(26)6-3-7-23(21)27)28-25(32)18-5-2-4-17(13-18)15-35-20-10-8-19(9-11-20)31(33)34/h2-13H,14-15H2,1H3,(H,28,29,32) |
| InChIKey | VXPVRHHDJIPXCG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|