C24H18Cl2N4O4 — CID 19287862
N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide (PubChem CID 19287862) has the molecular formula C24H18Cl2N4O4 and a molecular weight of 497.34 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide.
| Compound Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19287862 |
| Molecular Formula | C24H18Cl2N4O4 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(4-nitrophenoxy)methyl]benzamide |
| SMILES | O=C(Nc1nn(Cc2ccccc2Cl)cc1Cl)c1cccc(COc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C24H18Cl2N4O4/c25-21-7-2-1-5-18(21)13-29-14-22(26)23(28-29)27-24(31)17-6-3-4-16(12-17)15-34-20-10-8-19(9-11-20)30(32)33/h1-12,14H,13,15H2,(H,27,28,31) |
| InChIKey | FYBFTEMTHKKWCN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|