C25H22ClN3O3 — CID 19400684
N-(1-benzyl-4-chloropyrazol-3-yl)-3-[(2-methoxyphenoxy)methyl]benzamide (PubChem CID 19400684) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-3-[(2-methoxyphenoxy)methyl]benzamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-3-[(2-methoxyphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19400684 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-3-[(2-methoxyphenoxy)methyl]benzamide |
| SMILES | COc1ccccc1OCc1cccc(C(=O)Nc2nn(Cc3ccccc3)cc2Cl)c1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-31-22-12-5-6-13-23(22)32-17-19-10-7-11-20(14-19)25(30)27-24-21(26)16-29(28-24)15-18-8-3-2-4-9-18/h2-14,16H,15,17H2,1H3,(H,27,28,30) |
| InChIKey | ZHYNOXBJPJISLB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |