C25H19Cl3N4O4 — CID 19398758
N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide (PubChem CID 19398758) has the molecular formula C25H19Cl3N4O4 and a molecular weight of 545.81 g/mol. Its IUPAC name is N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide.
| Compound Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19398758 |
| Molecular Formula | C25H19Cl3N4O4 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide |
| SMILES | Cc1ccc(OCc2cccc(C(=O)Nc3nn(Cc4ccc(Cl)c(Cl)c4)cc3Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19Cl3N4O4/c1-15-5-8-23(22(9-15)32(34)35)36-14-17-3-2-4-18(10-17)25(33)29-24-21(28)13-31(30-24)12-16-6-7-19(26)20(27)11-16/h2-11,13H,12,14H2,1H3,(H,29,30,33) |
| InChIKey | LMEQBGFQULGQFN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|