C25H20ClFN4O4 — CID 19410495
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide (PubChem CID 19410495) has the molecular formula C25H20ClFN4O4 and a molecular weight of 494.91 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19410495 |
| Molecular Formula | C25H20ClFN4O4 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[(4-methyl-2-nitrophenoxy)methyl]benzamide |
| SMILES | Cc1ccc(OCc2cccc(C(=O)Nc3cnn(Cc4c(F)cccc4Cl)c3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20ClFN4O4/c1-16-8-9-24(23(10-16)31(33)34)35-15-17-4-2-5-18(11-17)25(32)29-19-12-28-30(13-19)14-20-21(26)6-3-7-22(20)27/h2-13H,14-15H2,1H3,(H,29,32) |
| InChIKey | QMGPOSBVKGLNME-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|