C23H18ClFN4O5 — CID 19410485
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19410485) has the molecular formula C23H18ClFN4O5 and a molecular weight of 484.87 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19410485 |
| Molecular Formula | C23H18ClFN4O5 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3cnn(Cc4c(F)cccc4Cl)c3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18ClFN4O5/c1-14-9-16(5-7-21(14)29(31)32)33-13-17-6-8-22(34-17)23(30)27-15-10-26-28(11-15)12-18-19(24)3-2-4-20(18)25/h2-11H,12-13H2,1H3,(H,27,30) |
| InChIKey | MAPKRTTZEUWOBK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|