C24H19F3N4O5 — CID 19346883
5-[(3-methyl-4-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19346883) has the molecular formula C24H19F3N4O5 and a molecular weight of 500.43 g/mol. Its IUPAC name is 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19346883 |
| Molecular Formula | C24H19F3N4O5 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3cnn(Cc4cccc(C(F)(F)F)c4)c3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H19F3N4O5/c1-15-9-19(5-7-21(15)31(33)34)35-14-20-6-8-22(36-20)23(32)29-18-11-28-30(13-18)12-16-3-2-4-17(10-16)24(25,26)27/h2-11,13H,12,14H2,1H3,(H,29,32) |
| InChIKey | ZBMRNAJJZIIIBF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|