C23H17F3N4O5 — CID 19346795
5-[(2-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19346795) has the molecular formula C23H17F3N4O5 and a molecular weight of 486.41 g/mol. Its IUPAC name is 5-[(2-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(2-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19346795 |
| Molecular Formula | C23H17F3N4O5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 5-[(2-nitrophenoxy)methyl]-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2cccc(C(F)(F)F)c2)c1)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C23H17F3N4O5/c24-23(25,26)16-5-3-4-15(10-16)12-29-13-17(11-27-29)28-22(31)21-9-8-18(35-21)14-34-20-7-2-1-6-19(20)30(32)33/h1-11,13H,12,14H2,(H,28,31) |
| InChIKey | JQRVFPHRUDYGQJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|