C25H24N4O6 — CID 19461723
N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461723) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461723 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[1-[(2,4-dimethylphenoxy)methyl]pyrazol-4-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCn2cc(NC(=O)c3ccc(COc4ccc([N+](=O)[O-])c(C)c4)o3)cn2)c(C)c1 |
| InChI | InChI=1S/C25H24N4O6/c1-16-4-8-23(18(3)10-16)34-15-28-13-19(12-26-28)27-25(30)24-9-6-21(35-24)14-33-20-5-7-22(29(31)32)17(2)11-20/h4-13H,14-15H2,1-3H3,(H,27,30) |
| InChIKey | QVFAITGUWUFSGE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|