C26H23ClFN3O2 — CID 19409118
N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(4-ethylphenoxy)methyl]benzamide (PubChem CID 19409118) has the molecular formula C26H23ClFN3O2 and a molecular weight of 463.94 g/mol. Its IUPAC name is N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(4-ethylphenoxy)methyl]benzamide.
| Compound Name | N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(4-ethylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19409118 |
| Molecular Formula | C26H23ClFN3O2 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(4-ethylphenoxy)methyl]benzamide |
| SMILES | CCc1ccc(OCc2cccc(C(=O)Nc3nn(Cc4ccc(F)cc4)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C26H23ClFN3O2/c1-2-18-8-12-23(13-9-18)33-17-20-4-3-5-21(14-20)26(32)29-25-24(27)16-31(30-25)15-19-6-10-22(28)11-7-19/h3-14,16H,2,15,17H2,1H3,(H,29,30,32) |
| InChIKey | IKLRYOBUNCRMFD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |