C19H17ClFN3O3 — CID 19409221
N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3,4-dimethoxybenzamide (PubChem CID 19409221) has the molecular formula C19H17ClFN3O3 and a molecular weight of 389.81 g/mol. Its IUPAC name is N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 19409221 |
| Molecular Formula | C19H17ClFN3O3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nn(Cc3ccc(F)cc3)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H17ClFN3O3/c1-26-16-8-5-13(9-17(16)27-2)19(25)22-18-15(20)11-24(23-18)10-12-3-6-14(21)7-4-12/h3-9,11H,10H2,1-2H3,(H,22,23,25) |
| InChIKey | GQJNMJSKHHOWFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |