C18H20F4N4O3 — CID 19410736
1-ethyl-N-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-3-carboxamide (PubChem CID 19410736) has the molecular formula C18H20F4N4O3 and a molecular weight of 416.38 g/mol. Its IUPAC name is 1-ethyl-N-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19410736 |
| Molecular Formula | C18H20F4N4O3 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-ethyl-N-methyl-4-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cccc(COCC(F)(F)C(F)F)c2)c(C(=O)NC)n1 |
| InChI | InChI=1S/C18H20F4N4O3/c1-3-26-8-13(14(25-26)16(28)23-2)24-15(27)12-6-4-5-11(7-12)9-29-10-18(21,22)17(19)20/h4-8,17H,3,9-10H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | CFQSBQDPAVQVLZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|