C18H20BrF4N3O2 — CID 19451873
N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 19451873) has the molecular formula C18H20BrF4N3O2 and a molecular weight of 466.27 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 19451873 |
| Molecular Formula | C18H20BrF4N3O2 |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | CCn1cc(Br)c(CN(C)C(=O)c2cccc(COCC(F)(F)C(F)F)c2)n1 |
| InChI | InChI=1S/C18H20BrF4N3O2/c1-3-26-8-14(19)15(24-26)9-25(2)16(27)13-6-4-5-12(7-13)10-28-11-18(22,23)17(20)21/h4-8,17H,3,9-11H2,1-2H3 |
| InChIKey | FPJHVERFNWRUFD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|