C25H27BrN4O — CID 19451818
1-benzyl-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N,2,3-trimethylindole-5-carboxamide (PubChem CID 19451818) has the molecular formula C25H27BrN4O and a molecular weight of 479.42 g/mol. Its IUPAC name is 1-benzyl-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N,2,3-trimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N,2,3-trimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 19451818 |
| Molecular Formula | C25H27BrN4O |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 1-benzyl-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-N,2,3-trimethylindole-5-carboxamide |
| SMILES | CCn1cc(Br)c(CN(C)C(=O)c2ccc3c(c2)c(C)c(C)n3Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H27BrN4O/c1-5-29-15-22(26)23(27-29)16-28(4)25(31)20-11-12-24-21(13-20)17(2)18(3)30(24)14-19-9-7-6-8-10-19/h6-13,15H,5,14,16H2,1-4H3 |
| InChIKey | ACIRJTZZQZBPFG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|