C29H31N3O — CID 1040631
(1-benzyl-2,3-dimethylindol-5-yl)-(4-benzylpiperazin-1-yl)methanone (PubChem CID 1040631) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is (1-benzyl-2,3-dimethylindol-5-yl)-(4-benzylpiperazin-1-yl)methanone.
| Compound Name | (1-benzyl-2,3-dimethylindol-5-yl)-(4-benzylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1040631 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (1-benzyl-2,3-dimethylindol-5-yl)-(4-benzylpiperazin-1-yl)methanone |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)N3CCN(Cc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C29H31N3O/c1-22-23(2)32(21-25-11-7-4-8-12-25)28-14-13-26(19-27(22)28)29(33)31-17-15-30(16-18-31)20-24-9-5-3-6-10-24/h3-14,19H,15-18,20-21H2,1-2H3 |
| InChIKey | NVAGGRBLSDEQHV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|