C17H22N2OS — CID 5015099
(1-ethyl-2,3-dimethylindol-5-yl)-thiomorpholin-4-ylmethanone (PubChem CID 5015099) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is (1-ethyl-2,3-dimethylindol-5-yl)-thiomorpholin-4-ylmethanone.
| Compound Name | (1-ethyl-2,3-dimethylindol-5-yl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 5015099 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1-ethyl-2,3-dimethylindol-5-yl)-thiomorpholin-4-ylmethanone |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)N3CCSCC3)ccc21 |
| InChI | InChI=1S/C17H22N2OS/c1-4-19-13(3)12(2)15-11-14(5-6-16(15)19)17(20)18-7-9-21-10-8-18/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | QQZZUTIMGRAMJH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|