1-ethyl-2,3-dimethylindole-5-carboxylic acid

C13H15NO2 — CID 608826

IUPAC1-ethyl-2,3-dimethylindole-5-carboxylic acid
SMILESCCn1c(C)c(C)c2cc(C(=O)O)ccc21
InChIInChI=1S/C13H15NO2/c1-4-14-9(3)8(2)11-7-10(13(15)16)5-6-12(11)14/h5-7H,4H2,1-3H3,(H,15,16)
InChIKeyJBWZIRYKBWGONS-UHFFFAOYSA-N
MW217.27 g/mol
LogP2.98
Rot. Bonds2

About 1-ethyl-2,3-dimethylindole-5-carboxylic acid

1-ethyl-2,3-dimethylindole-5-carboxylic acid (PubChem CID 608826) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylindole-5-carboxylic acid.

Molecular Properties

Compound Name1-ethyl-2,3-dimethylindole-5-carboxylic acid
PubChem CID608826
Molecular FormulaC13H15NO2
Molecular Weight217.27 g/mol
Exact Mass217.11
IUPAC Name1-ethyl-2,3-dimethylindole-5-carboxylic acid
SMILESCCn1c(C)c(C)c2cc(C(=O)O)ccc21
InChIInChI=1S/C13H15NO2/c1-4-14-9(3)8(2)11-7-10(13(15)16)5-6-12(11)14/h5-7H,4H2,1-3H3,(H,15,16)
InChIKeyJBWZIRYKBWGONS-UHFFFAOYSA-N
XLogP2.98
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.27
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 1-ethyl-2,3-dimethylindole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-2,3-dimethylindole-5-carboxylic acid?
The IUPAC name of 1-ethyl-2,3-dimethylindole-5-carboxylic acid (CID 608826) is 1-ethyl-2,3-dimethylindole-5-carboxylic acid.
What is the SMILES notation for 1-ethyl-2,3-dimethylindole-5-carboxylic acid?
The canonical SMILES for 1-ethyl-2,3-dimethylindole-5-carboxylic acid is CCn1c(C)c(C)c2cc(C(=O)O)ccc21.
What is the InChIKey of 1-ethyl-2,3-dimethylindole-5-carboxylic acid?
The InChIKey is JBWZIRYKBWGONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-4-14-9(3)8(2)11-7-10(13(15)16)5-6-12(11)14/h5-7H,4H2,1-3H3,(H,15,16).
What are the key properties of 1-ethyl-2,3-dimethylindole-5-carboxylic acid?
1-ethyl-2,3-dimethylindole-5-carboxylic acid has a molecular weight of 217.27 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethylindole-5-carboxylic acid is sourced from PubChem (CID 608826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).