C19H17NO4 — CID 59331093
9-ethyl-6-(3-oxobutanoyl)carbazole-3-carboxylic acid (PubChem CID 59331093) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 9-ethyl-6-(3-oxobutanoyl)carbazole-3-carboxylic acid.
| Compound Name | 9-ethyl-6-(3-oxobutanoyl)carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 59331093 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 9-ethyl-6-(3-oxobutanoyl)carbazole-3-carboxylic acid |
| SMILES | CCn1c2ccc(C(=O)O)cc2c2cc(C(=O)CC(C)=O)ccc21 |
| InChI | InChI=1S/C19H17NO4/c1-3-20-16-6-4-12(18(22)8-11(2)21)9-14(16)15-10-13(19(23)24)5-7-17(15)20/h4-7,9-10H,3,8H2,1-2H3,(H,23,24) |
| InChIKey | DIQPGZHBUGYLIQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|