C23H19Cl2IN2O4 — CID 157061011
4-chloro-1-ethyl-6-iodoquinolin-2-one;4-chloro-1-ethyl-2-oxoquinoline-6-carboxylic acid (PubChem CID 157061011) has the molecular formula C23H19Cl2IN2O4 and a molecular weight of 585.23 g/mol. Its IUPAC name is 4-chloro-1-ethyl-6-iodoquinolin-2-one;4-chloro-1-ethyl-2-oxoquinoline-6-carboxylic acid.
| Compound Name | 4-chloro-1-ethyl-6-iodoquinolin-2-one;4-chloro-1-ethyl-2-oxoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 157061011 |
| Molecular Formula | C23H19Cl2IN2O4 |
| Molecular Weight | 585.23 g/mol |
| Exact Mass | 583.98 |
| IUPAC Name | 4-chloro-1-ethyl-6-iodoquinolin-2-one;4-chloro-1-ethyl-2-oxoquinoline-6-carboxylic acid |
| SMILES | CCn1c(=O)cc(Cl)c2cc(C(=O)O)ccc21.CCn1c(=O)cc(Cl)c2cc(I)ccc21 |
| InChI | InChI=1S/C12H10ClNO3.C11H9ClINO/c1-2-14-10-4-3-7(12(16)17)5-8(10)9(13)6-11(14)15;1-2-14-10-4-3-7(13)5-8(10)9(12)6-11(14)15/h3-6H,2H2,1H3,(H,16,17);3-6H,2H2,1H3 |
| InChIKey | ABIHAJYVVMEHMN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.23 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|