C16H19NO2 — CID 83946773
9-ethyl-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 83946773) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 9-ethyl-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-ethyl-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83946773 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 9-ethyl-6-methyl-5,6,7,8-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCn1c2c(c3cc(C(=O)O)ccc31)CC(C)CC2 |
| InChI | InChI=1S/C16H19NO2/c1-3-17-14-6-4-10(2)8-12(14)13-9-11(16(18)19)5-7-15(13)17/h5,7,9-10H,3-4,6,8H2,1-2H3,(H,18,19) |
| InChIKey | XCHQHGFVNOUYDJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|