C26H35N3O — CID 143296378
acetylene;[2-(cyclopropylmethyl)-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 143296378) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is acetylene;[2-(cyclopropylmethyl)-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | acetylene;[2-(cyclopropylmethyl)-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 143296378 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | acetylene;[2-(cyclopropylmethyl)-5-ethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | C#C.CCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(CC1CC1)CC2 |
| InChI | InChI=1S/C24H33N3O.C2H2/c1-3-27-22-7-6-19(24(28)26-12-8-17(2)9-13-26)14-20(22)21-16-25(11-10-23(21)27)15-18-4-5-18;1-2/h6-7,14,17-18H,3-5,8-13,15-16H2,1-2H3;1-2H |
| InChIKey | AGEXISGFEPELIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|