C32H40N4O2 — CID 11853345
[5-[(4-ethoxyphenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 11853345) has the molecular formula C32H40N4O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is [5-[(4-ethoxyphenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [5-[(4-ethoxyphenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 11853345 |
| Molecular Formula | C32H40N4O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | [5-[(4-ethoxyphenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCOc1ccc(Cn2c3c(c4cc(C(=O)N5CCC(C)CC5)ccc42)CN(C2=NCCCC2)CC3)cc1 |
| InChI | InChI=1S/C32H40N4O2/c1-3-38-26-10-7-24(8-11-26)21-36-29-12-9-25(32(37)34-17-13-23(2)14-18-34)20-27(29)28-22-35(19-15-30(28)36)31-6-4-5-16-33-31/h7-12,20,23H,3-6,13-19,21-22H2,1-2H3 |
| InChIKey | MVQIHKKAKYQECC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|