C30H35N3O3S — CID 89069284
prop-1-en-2-yl 8-(4-methylpiperidine-1-carbonyl)-5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 89069284) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is prop-1-en-2-yl 8-(4-methylpiperidine-1-carbonyl)-5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | prop-1-en-2-yl 8-(4-methylpiperidine-1-carbonyl)-5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 89069284 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | prop-1-en-2-yl 8-(4-methylpiperidine-1-carbonyl)-5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCc2c(c3cc(C(=O)N4CCC(C)CC4)ccc3n2Cc2ccc(SC)cc2)C1 |
| InChI | InChI=1S/C30H35N3O3S/c1-20(2)36-30(35)32-16-13-28-26(19-32)25-17-23(29(34)31-14-11-21(3)12-15-31)7-10-27(25)33(28)18-22-5-8-24(37-4)9-6-22/h5-10,17,21H,1,11-16,18-19H2,2-4H3 |
| InChIKey | ULQCLVOVVMUBTK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|