C14H13NO4 — CID 83948273
4-(carboxymethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carboxylic acid (PubChem CID 83948273) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-(carboxymethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carboxylic acid.
| Compound Name | 4-(carboxymethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 83948273 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(carboxymethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carboxylic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(C(=O)O)ccc31)CCC2 |
| InChI | InChI=1S/C14H13NO4/c16-13(17)7-15-11-3-1-2-9(11)10-6-8(14(18)19)4-5-12(10)15/h4-6H,1-3,7H2,(H,16,17)(H,18,19) |
| InChIKey | NEPMAFPSRJMRGW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|