C15H16FNO2 — CID 82121618
9-ethyl-6-fluoro-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 82121618) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is 9-ethyl-6-fluoro-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-ethyl-6-fluoro-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82121618 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 9-ethyl-6-fluoro-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCn1c2c(c3cc(F)ccc31)CC(C(=O)O)CC2 |
| InChI | InChI=1S/C15H16FNO2/c1-2-17-13-5-3-9(15(18)19)7-11(13)12-8-10(16)4-6-14(12)17/h4,6,8-9H,2-3,5,7H2,1H3,(H,18,19) |
| InChIKey | GYIWMSOKPHUQOS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|