C16H19FN2O — CID 84613298
6-fluoro-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 84613298) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 6-fluoro-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 6-fluoro-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 84613298 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-fluoro-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | CC(C)n1c2c(c3cc(F)ccc31)CC(C(N)=O)CC2 |
| InChI | InChI=1S/C16H19FN2O/c1-9(2)19-14-5-3-10(16(18)20)7-12(14)13-8-11(17)4-6-15(13)19/h4,6,8-10H,3,5,7H2,1-2H3,(H2,18,20) |
| InChIKey | XVFQUSNASIIGIL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |