C18H25N3O — CID 84613299
6,7-dimethyl-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carbohydrazide (PubChem CID 84613299) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 6,7-dimethyl-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carbohydrazide.
| Compound Name | 6,7-dimethyl-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carbohydrazide |
|---|---|
| PubChem CID | 84613299 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 6,7-dimethyl-9-propan-2-yl-1,2,3,4-tetrahydrocarbazole-3-carbohydrazide |
| SMILES | Cc1cc2c3c(n(C(C)C)c2cc1C)CCC(C(=O)NN)C3 |
| InChI | InChI=1S/C18H25N3O/c1-10(2)21-16-6-5-13(18(22)20-19)9-15(16)14-7-11(3)12(4)8-17(14)21/h7-8,10,13H,5-6,9,19H2,1-4H3,(H,20,22) |
| InChIKey | JPQDUQYQBQMJJT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|