C15H19N3O — CID 878821
[(1S)-6,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-yl]urea (PubChem CID 878821) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is [(1S)-6,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-yl]urea.
| Compound Name | [(1S)-6,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-yl]urea |
|---|---|
| PubChem CID | 878821 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | [(1S)-6,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-yl]urea |
| SMILES | Cc1ccc2c(c1)c1c(n2C)[C@@H](NC(N)=O)CCC1 |
| InChI | InChI=1S/C15H19N3O/c1-9-6-7-13-11(8-9)10-4-3-5-12(17-15(16)19)14(10)18(13)2/h6-8,12H,3-5H2,1-2H3,(H3,16,17,19)/t12-/m0/s1 |
| InChIKey | SXLLTOFPNLDLTG-LBPRGKRZSA-N |
| XLogP | 2.53 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|