C18H24N2 — CID 1040358
(5S)-12-methyl-4-propyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (PubChem CID 1040358) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (5S)-12-methyl-4-propyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene.
| Compound Name | (5S)-12-methyl-4-propyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
|---|---|
| PubChem CID | 1040358 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (5S)-12-methyl-4-propyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES | CCCN1CCn2c3c(c4cc(C)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C18H24N2/c1-3-9-19-10-11-20-16-8-7-13(2)12-15(16)14-5-4-6-17(19)18(14)20/h7-8,12,17H,3-6,9-11H2,1-2H3/t17-/m0/s1 |
| InChIKey | PZJFUEZZZSTPSH-KRWDZBQOSA-N |
| XLogP | 4.05 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|